cas: 1203651-07-3 — see every product listed under this CAS number, including other names
tert-Butyl ((3S,5R)-5-methylpiperidin-3-yl)carbamate, 97%, 97% (CAS 1203651-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKOO-100mg |
| cas | 1203651-07-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1360.40 Pln | |
| Chemat | 5g | 4984.40 Pln | |
| Chemat | 10g | 9626.00 Pln | |
| Chemat | 500mg | 813.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3S,5R)-5-methylpiperidin-3-yl]carbamate (CAS 1203651-07-3) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3S,5R)-5-methylpiperidin-3-yl]carbamate. InChIKey: CNALVHVMBXLLIY-BDAKNGLRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3S,5R)-5-methylpiperidin-3-yl]carbamate |
| InChIKey | CNALVHVMBXLLIY-BDAKNGLRSA-N |
| SMILES | C[C@@H]1C[C@@H](CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)