cas: 305372-39-8 — see every product listed under this CAS number, including other names
(3aS,4S,6aR)-N-[2-[2-[2-[[3-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]ethoxy]ethyl]hexahydro-2-oxo-1H-thieno[3,4-d]imidazole-4-pentanamide, 95%, 95% (CAS 305372-39-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1141HI-50mg |
| cas | 305372-39-8 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 174.80 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 1350.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (CAS 305372-39-8) is a chemical compound with the molecular formula C23H35N5O7S and a molecular weight of 525.6 g/mol. IUPAC name: N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide. InChIKey: UDPCXVIKHFVPSZ-UHFFFAOYSA-N.
| Molecular formula | C23H35N5O7S |
|---|---|
| Molecular weight | 525.6 g/mol |
| IUPAC name | N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChIKey | UDPCXVIKHFVPSZ-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCNC(=O)CCN3C(=O)C=CC3=O)NC(=O)N2 |
Computed by PubChem (NCBI)