cas: 305372-39-8 — see every product listed under this CAS number, including other names
Biotin-PEG2-Mal, 99.64% (CAS 305372-39-8) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g, 100 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W010764-5 g |
| cas | 305372-39-8 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 8274.86 Pln | |
| MedChemExpress | 1 g | 2028.68 Pln | |
| MedChemExpress | 100 mg | 394.00 Pln | |
| MedChemExpress | 250 mg | 598.33 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.64% |
N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (CAS 305372-39-8) is a chemical compound with the molecular formula C23H35N5O7S and a molecular weight of 525.6 g/mol. IUPAC name: N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide. InChIKey: UDPCXVIKHFVPSZ-UHFFFAOYSA-N.
| Molecular formula | C23H35N5O7S |
|---|---|
| Molecular weight | 525.6 g/mol |
| IUPAC name | N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChIKey | UDPCXVIKHFVPSZ-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCNC(=O)CCN3C(=O)C=CC3=O)NC(=O)N2 |
Computed by PubChem (NCBI)