Biotin-PEG2-Mal 90%
cas: 305372-39-8 — see every product listed under this CAS number, including other names
Biotin-PEG2-Mal 90% (CAS 305372-39-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A764213-100mg |
| cas | 305372-39-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 370.38 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1482.88 Pln | |
| Ambeed | 50mg | 248.00 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A764213 |
N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (CAS 305372-39-8) is a chemical compound with the molecular formula C23H35N5O7S and a molecular weight of 525.6 g/mol. IUPAC name: N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide. InChIKey: UDPCXVIKHFVPSZ-UHFFFAOYSA-N.
| Molecular formula | C23H35N5O7S |
|---|---|
| Molecular weight | 525.6 g/mol |
| IUPAC name | N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChIKey | UDPCXVIKHFVPSZ-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCNC(=O)CCN3C(=O)C=CC3=O)NC(=O)N2 |
Computed by PubChem (NCBI)