cas: 305372-39-8 — see every product listed under this CAS number, including other names
N-(2-(2-(2-(3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamido)ethoxy)ethoxy)ethyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide, 90% (CAS 305372-39-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869283-5G |
| cas | 305372-39-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 7500.50 Pln | |
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 1544.27 Pln |
| purity | 90% |
|---|---|
| delivery time | 3-4 weeks |
N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (CAS 305372-39-8) is a chemical compound with the molecular formula C23H35N5O7S and a molecular weight of 525.6 g/mol. IUPAC name: N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide. InChIKey: UDPCXVIKHFVPSZ-UHFFFAOYSA-N.
| Molecular formula | C23H35N5O7S |
|---|---|
| Molecular weight | 525.6 g/mol |
| IUPAC name | N-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChIKey | UDPCXVIKHFVPSZ-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCNC(=O)CCN3C(=O)C=CC3=O)NC(=O)N2 |
Computed by PubChem (NCBI)