cas: 104010-72-2 — see every product listed under this CAS number, including other names
(3aS,6aS)-2,2-Dimethyl-3aH-cyclopenta[d][1,3]dioxol-4(6aH)-one, 98%, 98% (CAS 104010-72-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119UP5-250mg |
| cas | 104010-72-2 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 500mg | 174.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 736.40 Pln | |
| Chemat | 10g | 1110.80 Pln | |
| Chemat | 25g | 2502.80 Pln | |
| Chemat | 100g | 9347.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3aS,6aS)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one (CAS 104010-72-2) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (3aS,6aS)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one. InChIKey: UWXUDHGKUWPPGB-NKWVEPMBSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (3aS,6aS)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
| InChIKey | UWXUDHGKUWPPGB-NKWVEPMBSA-N |
| SMILES | CC1(O[C@H]2C=CC(=O)[C@H]2O1)C |
Computed by PubChem (NCBI)