CAS 103904-94-5 appears in our catalog under these names: (+)-(3AS,6aS)-3a,6a-dihydro-2,2-dimethyl-4h-cyclopenta-1,3-dioxol-4-one, 95%, (3aS,6aS)-3a,6a-Dihydro-2,2-dimethyl-4H-cyclopenta-1,3-dioxol-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 5g.
(3aS,6aS)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one (CAS 103904-94-5) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (3aS,6aS)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one. InChIKey: UWXUDHGKUWPPGB-NKWVEPMBSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (3aS,6aS)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
| InChIKey | UWXUDHGKUWPPGB-NKWVEPMBSA-N |
| SMILES | CC1(O[C@H]2C=CC(=O)[C@H]2O1)C |
Computed by PubChem (NCBI)