CAS 115509-13-2 appears in our catalog under these names: (3aR,6aR)-3a,6a-dihydro-2,2-dimethyl-4H-cyclopenta-1,3-dioxol-4-one, 98%, 98%, (3aR,6aR)-2,2-Dimethyl-3aH-cyclopenta[d][1,3]dioxol-4(6aH)-one, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
(3aR,6aR)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one (CAS 115509-13-2) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (3aR,6aR)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one. InChIKey: UWXUDHGKUWPPGB-RQJHMYQMSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (3aR,6aR)-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
| InChIKey | UWXUDHGKUWPPGB-RQJHMYQMSA-N |
| SMILES | CC1(O[C@@H]2C=CC(=O)[C@@H]2O1)C |
Computed by PubChem (NCBI)