cas: 501944-49-6 — see every product listed under this CAS number, including other names
(4'-(tert-Butyl)-[1,1'-biphenyl]-4-yl)boronic acid, 95%, 95% (CAS 501944-49-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9Z9-100mg |
| cas | 501944-49-6 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3506.00 Pln | |
| Chemat | 100g | 5229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(4-tert-butylphenyl)phenyl]boronic acid (CAS 501944-49-6) is a chemical compound with the molecular formula C16H19BO2 and a molecular weight of 254.1 g/mol. IUPAC name: [4-(4-tert-butylphenyl)phenyl]boronic acid. InChIKey: ROWGMWCSASZVBF-UHFFFAOYSA-N.
| Molecular formula | C16H19BO2 |
|---|---|
| Molecular weight | 254.1 g/mol |
| IUPAC name | [4-(4-tert-butylphenyl)phenyl]boronic acid |
| InChIKey | ROWGMWCSASZVBF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)