Products 501944-49-6
CAS 501944-49-6 appears in our catalog under these names: 4-(4-tert-butylphenyl)phenylboronic acid, 98%, (4'-(tert-Butyl)-[1,1'-biphenyl]-4-yl)boronic acid, 95%, 95%, 4-(4-tert-Butylphenyl)phenylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g, 50g, 100g.
[4-(4-tert-butylphenyl)phenyl]boronic acid (CAS 501944-49-6) is a chemical compound with the molecular formula C16H19BO2 and a molecular weight of 254.1 g/mol. IUPAC name: [4-(4-tert-butylphenyl)phenyl]boronic acid. InChIKey: ROWGMWCSASZVBF-UHFFFAOYSA-N.
| Molecular formula | C16H19BO2 |
|---|---|
| Molecular weight | 254.1 g/mol |
| IUPAC name | [4-(4-tert-butylphenyl)phenyl]boronic acid |
| InChIKey | ROWGMWCSASZVBF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4'-(tert-Butyl)-[1,1'-biphenyl]-4-yl)boronic acid, [4-(4-tert-butylphenyl)phenyl]boronic acid, Boronic acid, [4'-(1,1-dimethylethyl)[1,1'-biphenyl]-4-yl]-, {4'-tert-butyl-[1,1'-biphenyl]-4-yl}boronic acid, (4'-(Tert-butyl)-[1,1'-biphenyl]-4-yl)boronicacid, B-[4'-(1,1-dimethylethyl)[1,1'-biphenyl]-4-yl]boronic acid