CAS 1228458-46-5 appears in our catalog under these names: (4'–(tert–Butyl)–(1,1'–biphenyl)–2–yl)boronic acid, (4'-(tert-Butyl)-[1,1'-biphenyl]-2-yl)boronic acid, 97%, 97%, (4'-(tert-Butyl)-[1,1'-biphenyl]-2-yl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
[2-(4-tert-butylphenyl)phenyl]boronic acid (CAS 1228458-46-5) is a chemical compound with the molecular formula C16H19BO2 and a molecular weight of 254.1 g/mol. IUPAC name: [2-(4-tert-butylphenyl)phenyl]boronic acid. InChIKey: MHASLDKIIDDISL-UHFFFAOYSA-N.
| Molecular formula | C16H19BO2 |
|---|---|
| Molecular weight | 254.1 g/mol |
| IUPAC name | [2-(4-tert-butylphenyl)phenyl]boronic acid |
| InChIKey | MHASLDKIIDDISL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=CC=C(C=C2)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)