Products 145413-17-8
CAS 145413-17-8 is the registry number for B-(4'-Butyl[1,1'-biphenyl]-4-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[4-(4-butylphenyl)phenyl]boronic acid (CAS 145413-17-8) is a chemical compound with the molecular formula C16H19BO2 and a molecular weight of 254.1 g/mol. IUPAC name: [4-(4-butylphenyl)phenyl]boronic acid. InChIKey: DKCMBSJGEAEGOE-UHFFFAOYSA-N.
| Molecular formula | C16H19BO2 |
|---|---|
| Molecular weight | 254.1 g/mol |
| IUPAC name | [4-(4-butylphenyl)phenyl]boronic acid |
| InChIKey | DKCMBSJGEAEGOE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)CCCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4'-Butyl-[1,1'-biphenyl]-4-yl)boronic acid, [4-(4-butylphenyl)phenyl]boronic acid, (4'-Butyl[1,1'-biphenyl]-4-yl)-boronic acid, B-(4'-butyl[1,1'-biphenyl]-4-yl)boronic acid, {4'-butyl-[1,1'-biphenyl]-4-yl}boronic acid, Boronic acid, B-(4'-butyl[1,1'-biphenyl]-4-yl)-, 4'-butylbiphenyl-4-ylboronic acid, 4'-Butyl-4-biphenylboronic acid, (4'-Butyl[1,1'-biphenyl]-4-yl)boronic acid, 4'-butylbiphenyl-4-boronic acid