cas: 60277-22-7 — see every product listed under this CAS number, including other names
(4'-Methoxy-biphenyl-4-yl)-acetic acid 98% (CAS 60277-22-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A292343-100mg |
| cas | 60277-22-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 665.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A292343 |
2-[4-(4-methoxyphenyl)phenyl]acetic acid (CAS 60277-22-7) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-[4-(4-methoxyphenyl)phenyl]acetic acid. InChIKey: KJOHEDXEFMKOEF-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-[4-(4-methoxyphenyl)phenyl]acetic acid |
| InChIKey | KJOHEDXEFMKOEF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)