cas: 2586125-81-5 — see every product listed under this CAS number, including other names
(4,5-Dichloro-2-fluoro-3-methylphenyl)methanol, 98% (CAS 2586125-81-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1654502-25g |
| cas | 2586125-81-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 38492.02 Pln | |
| AmBeed | 5g | 11579.68 Pln | |
| AmBeed | 10g | 19619.53 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4,5-dichloro-2-fluoro-3-methylphenyl)methanol (CAS 2586125-81-5) is a chemical compound with the molecular formula C8H7Cl2FO and a molecular weight of 209.04 g/mol. IUPAC name: (4,5-dichloro-2-fluoro-3-methylphenyl)methanol. InChIKey: PTKKWVRTKGOFHJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2FO |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | (4,5-dichloro-2-fluoro-3-methylphenyl)methanol |
| InChIKey | PTKKWVRTKGOFHJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)Cl)CO)F |
Computed by PubChem (NCBI)