CAS 1780393-42-1 is the registry number for 3,6-Dichloro-2-fluoro-α-methylbenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,6-dichloro-2-fluorophenyl)ethanol (CAS 1780393-42-1) is a chemical compound with the molecular formula C8H7Cl2FO and a molecular weight of 209.04 g/mol. IUPAC name: 1-(3,6-dichloro-2-fluorophenyl)ethanol. InChIKey: TWDMTJWJAXFQAI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2FO |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 1-(3,6-dichloro-2-fluorophenyl)ethanol |
| InChIKey | TWDMTJWJAXFQAI-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1F)Cl)Cl)O |
Computed by PubChem (NCBI)