cas: 489446-42-6 — see every product listed under this CAS number, including other names
(4-(((tert-Butoxycarbonyl)amino)methyl)phenyl)boronic acid, 98.75% (CAS 489446-42-6) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 25 g, 10 g, 500 mg, 100 mg, 5 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W076728-1 g |
| cas | 489446-42-6 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 551.89 Pln | |
| MedChemExpress | 25 g | 2976.06 Pln | |
| MedChemExpress | 10 g | 1541.06 Pln | |
| MedChemExpress | 500 mg | 426.50 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 1202.05 Pln | |
| MedChemExpress | 250 mg | 333.62 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.75% |
[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid (CAS 489446-42-6) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid. InChIKey: MUBGEKQUCSEECZ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
| InChIKey | MUBGEKQUCSEECZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)