cas: 945756-49-0 — see every product listed under this CAS number, including other names
(4-((tert-Butoxycarbonyl)(methyl)amino)phenyl)boronic acid, 98% (CAS 945756-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218523-100MG |
| cas | 945756-49-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 2.5g | 664.37 Pln | |
| Fluorochem | 5g | 1096.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid (CAS 945756-49-0) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: [4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid. InChIKey: IPRHVYYSYKNJDE-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | [4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid |
| InChIKey | IPRHVYYSYKNJDE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(C)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)