(4-(2-Ethoxy-2-oxoethoxy)phenyl)boronic acid, 98%
cas: 282116-97-6 — see every product listed under this CAS number, including other names
(4-(2-Ethoxy-2-oxoethoxy)phenyl)boronic acid, 98% (CAS 282116-97-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A692441-100mg |
| cas | 282116-97-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 809.81 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 784.40 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 869.72 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[4-(2-ethoxy-2-oxoethoxy)phenyl]boronic acid (CAS 282116-97-6) is a chemical compound with the molecular formula C10H13BO5 and a molecular weight of 224.02 g/mol. IUPAC name: [4-(2-ethoxy-2-oxoethoxy)phenyl]boronic acid. InChIKey: MECJJOCHJYCOJS-UHFFFAOYSA-N.
| Molecular formula | C10H13BO5 |
|---|---|
| Molecular weight | 224.02 g/mol |
| IUPAC name | [4-(2-ethoxy-2-oxoethoxy)phenyl]boronic acid |
| InChIKey | MECJJOCHJYCOJS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC(=O)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(2-Ethoxy-2-oxoethoxy)benzeneboronic acid, (4-(2-Ethoxy-2-oxoethoxy)phenyl)boronic acid, 4-(2-Ethoxy-2-oxoethoxy)phenylboronic acid, [4-(2-ethoxy-2-oxoethoxy)phenyl]boronic acid, (4-(2-Ethoxy-2-oxoethoxy)phenyl)boronicacid, (4-(2-Eth, MECJJOCHJYCOJS-UHFFFAOYSA-N, 4-(2-ethoxy-2-oxoethoxy)-benzeneboronic acid, [4-(2-ethoxy-2-oxo-ethoxy)phenyl]boronic acid