CAS 1704069-40-8 is the registry number for (2–(1,3–Dioxolan–2–yl)–4–methoxyphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[2-(1,3-dioxolan-2-yl)-4-methoxyphenyl]boronic acid (CAS 1704069-40-8) is a chemical compound with the molecular formula C10H13BO5 and a molecular weight of 224.02 g/mol. IUPAC name: [2-(1,3-dioxolan-2-yl)-4-methoxyphenyl]boronic acid. InChIKey: LOUGDFYMXUHUSC-UHFFFAOYSA-N.
| Molecular formula | C10H13BO5 |
|---|---|
| Molecular weight | 224.02 g/mol |
| IUPAC name | [2-(1,3-dioxolan-2-yl)-4-methoxyphenyl]boronic acid |
| InChIKey | LOUGDFYMXUHUSC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C2OCCO2)(O)O |
Computed by PubChem (NCBI)