CAS 603122-86-7 appears in our catalog under these names: 4-Ethoxycarbonyl-2-methoxyphenylboronic acid, 95%, (4-(Ethoxycarbonyl)-2-methoxyphenyl)boronic acid, 95+%, 4-Ethoxycarbonyl-2-methoxyphenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(4-ethoxycarbonyl-2-methoxyphenyl)boronic acid (CAS 603122-86-7) is a chemical compound with the molecular formula C10H13BO5 and a molecular weight of 224.02 g/mol. IUPAC name: (4-ethoxycarbonyl-2-methoxyphenyl)boronic acid. InChIKey: BGZDEQUZDOOMMD-UHFFFAOYSA-N.
| Molecular formula | C10H13BO5 |
|---|---|
| Molecular weight | 224.02 g/mol |
| IUPAC name | (4-ethoxycarbonyl-2-methoxyphenyl)boronic acid |
| InChIKey | BGZDEQUZDOOMMD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OCC)OC)(O)O |
Computed by PubChem (NCBI)