CAS 957062-53-2 appears in our catalog under these names: 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid, 96%, (5-(Ethoxycarbonyl)-2-methoxyphenyl)boronic acid, (5-(Ethoxycarbonyl)-2-methoxyphenyl)boronic acid, 95%. Offered by: Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
(5-ethoxycarbonyl-2-methoxyphenyl)boronic acid (CAS 957062-53-2) is a chemical compound with the molecular formula C10H13BO5 and a molecular weight of 224.02 g/mol. IUPAC name: (5-ethoxycarbonyl-2-methoxyphenyl)boronic acid. InChIKey: NNQFBMDJWJUGQO-UHFFFAOYSA-N.
| Molecular formula | C10H13BO5 |
|---|---|
| Molecular weight | 224.02 g/mol |
| IUPAC name | (5-ethoxycarbonyl-2-methoxyphenyl)boronic acid |
| InChIKey | NNQFBMDJWJUGQO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)OCC)OC)(O)O |
Computed by PubChem (NCBI)