cas: 660440-57-3 — see every product listed under this CAS number, including other names
(4-(3-Ethoxy-3-oxopropyl)phenyl)boronic acid 98% (CAS 660440-57-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A253679-250mg |
| cas | 660440-57-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1132.44 Pln | |
| Ambeed | 25g | 4314.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A253679 |
[4-(3-ethoxy-3-oxopropyl)phenyl]boronic acid (CAS 660440-57-3) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: [4-(3-ethoxy-3-oxopropyl)phenyl]boronic acid. InChIKey: PRCOGZNDLWXGHB-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [4-(3-ethoxy-3-oxopropyl)phenyl]boronic acid |
| InChIKey | PRCOGZNDLWXGHB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCC(=O)OCC)(O)O |
Computed by PubChem (NCBI)