CAS 1615247-96-5 is the registry number for 4-(3-Methyloxetan-3-yl)methoxyphenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-[(3-methyloxetan-3-yl)methoxy]phenyl]boronic acid (CAS 1615247-96-5) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: [4-[(3-methyloxetan-3-yl)methoxy]phenyl]boronic acid. InChIKey: YUUJVQOVXJGZCL-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [4-[(3-methyloxetan-3-yl)methoxy]phenyl]boronic acid |
| InChIKey | YUUJVQOVXJGZCL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2(COC2)C)(O)O |
Computed by PubChem (NCBI)