Products 1055881-23-6
CAS 1055881-23-6 appears in our catalog under these names: 2-Formylfuran-3-boronic acid pinacol ester, 95%, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carbaldehyde, 98%, 2-FORMYLFURAN-3-BORONIC ACID PINACOL ESTER, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carbaldehyde (CAS 1055881-23-6) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carbaldehyde. InChIKey: PYPDEWSBYDJVFU-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carbaldehyde |
| InChIKey | PYPDEWSBYDJVFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(OC=C2)C=O |
Computed by PubChem (NCBI)