CAS 2096341-50-1 appears in our catalog under these names: 3,3-Dimethyl-2,4-dihydro-1,5-benzodioxepine-6-boronic acid, 97%, (3,3-Dimethyl-3,4-dihydro-2H-benzo(b)(1,4)dioxepin-6-yl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-6-yl)boronic acid (CAS 2096341-50-1) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: (3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-6-yl)boronic acid. InChIKey: KNSGTUKCVUWKKJ-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | (3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-6-yl)boronic acid |
| InChIKey | KNSGTUKCVUWKKJ-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OCC(CO2)(C)C)(O)O |
Computed by PubChem (NCBI)