cas: 913835-70-8 — see every product listed under this CAS number, including other names
(4-(5-Methyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid, 98% (CAS 913835-70-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235339-100MG |
| cas | 913835-70-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 1g | 987.17 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid (CAS 913835-70-8) is a chemical compound with the molecular formula C9H9BN2O3 and a molecular weight of 203.99 g/mol. IUPAC name: [4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid. InChIKey: SPSKFVHUUJWUPB-UHFFFAOYSA-N.
| Molecular formula | C9H9BN2O3 |
|---|---|
| Molecular weight | 203.99 g/mol |
| IUPAC name | [4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid |
| InChIKey | SPSKFVHUUJWUPB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NN=C(O2)C)(O)O |
Computed by PubChem (NCBI)