CAS 1217501-31-9 is the registry number for 3-(5-Methyl-1,2,4-oxadiazol-3-yl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid (CAS 1217501-31-9) is a chemical compound with the molecular formula C9H9BN2O3 and a molecular weight of 203.99 g/mol. IUPAC name: [3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid. InChIKey: KVUASKRUUOTZQN-UHFFFAOYSA-N.
| Molecular formula | C9H9BN2O3 |
|---|---|
| Molecular weight | 203.99 g/mol |
| IUPAC name | [3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid |
| InChIKey | KVUASKRUUOTZQN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NOC(=N2)C)(O)O |
Computed by PubChem (NCBI)