CAS 913835-70-8 appears in our catalog under these names: 4-(5-Methyl-1,3,4-oxadiazol-2-yl)phenylboronic acid, 98%, (4-(5-Methyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid 98%, 4-(5-Methyl-1,3,4-oxadiazol-2-yl)phenylboronic acid, 98%, 98%, (4-(5-Methyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid (CAS 913835-70-8) is a chemical compound with the molecular formula C9H9BN2O3 and a molecular weight of 203.99 g/mol. IUPAC name: [4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid. InChIKey: SPSKFVHUUJWUPB-UHFFFAOYSA-N.
| Molecular formula | C9H9BN2O3 |
|---|---|
| Molecular weight | 203.99 g/mol |
| IUPAC name | [4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid |
| InChIKey | SPSKFVHUUJWUPB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NN=C(O2)C)(O)O |
Computed by PubChem (NCBI)