CAS 913836-04-1 appears in our catalog under these names: (3-(5-Methyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid, 98%, (3-(5-Methyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid, 96%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 250mg, 100mg, 1g, 5g.
[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid (CAS 913836-04-1) is a chemical compound with the molecular formula C9H9BN2O3 and a molecular weight of 203.99 g/mol. IUPAC name: [3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid. InChIKey: GXJXMCCAPBQQHR-UHFFFAOYSA-N.
| Molecular formula | C9H9BN2O3 |
|---|---|
| Molecular weight | 203.99 g/mol |
| IUPAC name | [3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid |
| InChIKey | GXJXMCCAPBQQHR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NN=C(O2)C)(O)O |
Computed by PubChem (NCBI)