(4-(Aminomethyl)-3-fluorophenyl)boronic acid hydrochloride 97%
cas: 1072946-45-2 — see every product listed under this CAS number, including other names
(4-(Aminomethyl)-3-fluorophenyl)boronic acid hydrochloride 97% (CAS 1072946-45-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A307341-100mg |
| cas | 1072946-45-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2189.31 Pln | |
| Ambeed | 10g | 3891.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A307341 |
[4-(aminomethyl)-3-fluorophenyl]boronic acid;hydrochloride (CAS 1072946-45-2) is a chemical compound with the molecular formula C7H10BClFNO2 and a molecular weight of 205.42 g/mol. IUPAC name: [4-(aminomethyl)-3-fluorophenyl]boronic acid;hydrochloride. InChIKey: HOFYPLPXUYJZCR-UHFFFAOYSA-N.
| Molecular formula | C7H10BClFNO2 |
|---|---|
| Molecular weight | 205.42 g/mol |
| IUPAC name | [4-(aminomethyl)-3-fluorophenyl]boronic acid;hydrochloride |
| InChIKey | HOFYPLPXUYJZCR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN)F)(O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(Aminomethyl)-3-fluorophenylboronic acid, HCl, (4-(Aminomethyl)-3-fluorophenyl)boronic acid hydrochloride, 4-(Aminomethyl)-3-fluorophenylboronic acid hydrochloride, [4-(aminomethyl)-3-fluorophenyl]boronic acid;hydrochloride, (4-(Aminomethyl)-3-fluorophenyl)boronicacidhydrochloride, [4-(aminomethyl)-3-fluoro-phenyl]boronic acid hydrochloride, [4-(Aminomethyl)-3-fluorophenyl]boronic acid--hydrogen chloride (1/1), 4-(Aminomethyl)-3-fluorophenylboronic acid HCl, 4-(aminomethyl)-3-fluorophenylboronic acid HCl salt, [4-(aminomethyl)-3-fluoro-phenyl]boronic acid;hydrochloride