CAS 1072946-44-1 is the registry number for 3-(Aminomethyl)-2-fluorophenylboronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
[3-(aminomethyl)-2-fluorophenyl]boronic acid;hydrochloride (CAS 1072946-44-1) is a chemical compound with the molecular formula C7H10BClFNO2 and a molecular weight of 205.42 g/mol. IUPAC name: [3-(aminomethyl)-2-fluorophenyl]boronic acid;hydrochloride. InChIKey: PMVMFPKOYFRXRJ-UHFFFAOYSA-N.
| Molecular formula | C7H10BClFNO2 |
|---|---|
| Molecular weight | 205.42 g/mol |
| IUPAC name | [3-(aminomethyl)-2-fluorophenyl]boronic acid;hydrochloride |
| InChIKey | PMVMFPKOYFRXRJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)CN)F)(O)O.Cl |
Computed by PubChem (NCBI)