CAS 1072946-45-2 appears in our catalog under these names: 4-(Aminomethyl)-3-fluorophenylboronic acid hydrochloride, 98%, 4–(Aminomethyl)–3–fluorophenylboronic acid hydrochloride, (4-(Aminomethyl)-3-fluorophenyl)boronic acid hydrochloride 97%, (4-(Aminomethyl)-3-fluorophenyl)boronic acid hydrochloride, 97%, 97%, (4-(Aminomethyl)-3-fluorophenyl)boronic acid hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg, 500mg.
[4-(aminomethyl)-3-fluorophenyl]boronic acid;hydrochloride (CAS 1072946-45-2) is a chemical compound with the molecular formula C7H10BClFNO2 and a molecular weight of 205.42 g/mol. IUPAC name: [4-(aminomethyl)-3-fluorophenyl]boronic acid;hydrochloride. InChIKey: HOFYPLPXUYJZCR-UHFFFAOYSA-N.
| Molecular formula | C7H10BClFNO2 |
|---|---|
| Molecular weight | 205.42 g/mol |
| IUPAC name | [4-(aminomethyl)-3-fluorophenyl]boronic acid;hydrochloride |
| InChIKey | HOFYPLPXUYJZCR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN)F)(O)O.Cl |
Computed by PubChem (NCBI)