Products 850568-03-5

CAS 850568-03-5 is the registry number for 2-Aminomethyl-5-fluorophenylboronic acid hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

[2-(aminomethyl)-5-fluorophenyl]boronic acid;hydrochloride (CAS 850568-03-5) is a chemical compound with the molecular formula C7H10BClFNO2 and a molecular weight of 205.42 g/mol. IUPAC name: [2-(aminomethyl)-5-fluorophenyl]boronic acid;hydrochloride. InChIKey: URBGTEWFXWJWPS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BClFNO2
Molecular weight205.42 g/mol
IUPAC name[2-(aminomethyl)-5-fluorophenyl]boronic acid;hydrochloride
InChIKeyURBGTEWFXWJWPS-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)F)CN)(O)O.Cl

Computed by PubChem (NCBI)