CAS 850568-03-5 is the registry number for 2-Aminomethyl-5-fluorophenylboronic acid hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[2-(aminomethyl)-5-fluorophenyl]boronic acid;hydrochloride (CAS 850568-03-5) is a chemical compound with the molecular formula C7H10BClFNO2 and a molecular weight of 205.42 g/mol. IUPAC name: [2-(aminomethyl)-5-fluorophenyl]boronic acid;hydrochloride. InChIKey: URBGTEWFXWJWPS-UHFFFAOYSA-N.
| Molecular formula | C7H10BClFNO2 |
|---|---|
| Molecular weight | 205.42 g/mol |
| IUPAC name | [2-(aminomethyl)-5-fluorophenyl]boronic acid;hydrochloride |
| InChIKey | URBGTEWFXWJWPS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)CN)(O)O.Cl |
Computed by PubChem (NCBI)