cas: 1286264-52-5 — see every product listed under this CAS number, including other names
(4-(Aminomethyl)piperidin-1-yl)(phenyl)methanone hydrochloride 97% (CAS 1286264-52-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A570621-100mg |
| cas | 1286264-52-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 859.88 Pln | |
| Ambeed | 250mg | 1021.19 Pln | |
| Ambeed | 1g | 2172.62 Pln | |
| Ambeed | 5g | 4770.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A570621 |
[4-(aminomethyl)piperidin-1-yl]-phenylmethanone;hydrochloride (CAS 1286264-52-5) is a chemical compound with the molecular formula C13H19ClN2O and a molecular weight of 254.75 g/mol. IUPAC name: [4-(aminomethyl)piperidin-1-yl]-phenylmethanone;hydrochloride. InChIKey: RRRIKGNHSDPSOS-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | [4-(aminomethyl)piperidin-1-yl]-phenylmethanone;hydrochloride |
| InChIKey | RRRIKGNHSDPSOS-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CN)C(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)