Products 1820706-19-1
CAS 1820706-19-1 is the registry number for 4-(6-Chloro-5-methylpyridin-3-yl)-1-ethylpiperidin-4-ol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(6-chloro-5-methyl-3-pyridinyl)-1-ethylpiperidin-4-ol (CAS 1820706-19-1) is a chemical compound with the molecular formula C13H19ClN2O and a molecular weight of 254.75 g/mol. IUPAC name: 4-(6-chloro-5-methyl-3-pyridinyl)-1-ethylpiperidin-4-ol. InChIKey: YSKUHPFSORYOQD-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | 4-(6-chloro-5-methyl-3-pyridinyl)-1-ethylpiperidin-4-ol |
| InChIKey | YSKUHPFSORYOQD-UHFFFAOYSA-N |
| SMILES | CCN1CCC(CC1)(C2=CN=C(C(=C2)C)Cl)O |
Computed by PubChem (NCBI)