Products 341966-00-5
CAS 341966-00-5 is the registry number for 3-Chloro-n-[4-(dimethylamino)phenyl]-2,2-dimethylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
3-chloro-N-[4-(dimethylamino)phenyl]-2,2-dimethylpropanamide (CAS 341966-00-5) is a chemical compound with the molecular formula C13H19ClN2O and a molecular weight of 254.75 g/mol. IUPAC name: 3-chloro-N-[4-(dimethylamino)phenyl]-2,2-dimethylpropanamide. InChIKey: AOGSQXNQWJNTPY-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | 3-chloro-N-[4-(dimethylamino)phenyl]-2,2-dimethylpropanamide |
| InChIKey | AOGSQXNQWJNTPY-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)C(=O)NC1=CC=C(C=C1)N(C)C |
Computed by PubChem (NCBI)