Products 1820666-52-1

CAS 1820666-52-1 is the registry number for N-Acetyl 4-piperidinoaniline hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

N-(4-piperidin-1-ylphenyl)acetamide;hydrochloride (CAS 1820666-52-1) is a chemical compound with the molecular formula C13H19ClN2O and a molecular weight of 254.75 g/mol. IUPAC name: N-(4-piperidin-1-ylphenyl)acetamide;hydrochloride. InChIKey: WFVXKJFSFJRPOO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19ClN2O
Molecular weight254.75 g/mol
IUPAC nameN-(4-piperidin-1-ylphenyl)acetamide;hydrochloride
InChIKeyWFVXKJFSFJRPOO-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=C(C=C1)N2CCCCC2.Cl

Computed by PubChem (NCBI)