cas: 1072945-68-6 — see every product listed under this CAS number, including other names
(4-(Cyclopropanesulfonamido)phenyl)boronic acid, 98% (CAS 1072945-68-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447513-100MG |
| cas | 1072945-68-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 612.30 Pln | |
| Fluorochem | 1g | 1528.65 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-(cyclopropylsulfonylamino)phenyl]boronic acid (CAS 1072945-68-6) is a chemical compound with the molecular formula C9H12BNO4S and a molecular weight of 241.08 g/mol. IUPAC name: [4-(cyclopropylsulfonylamino)phenyl]boronic acid. InChIKey: RYFOEMWOTGVANV-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4S |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | [4-(cyclopropylsulfonylamino)phenyl]boronic acid |
| InChIKey | RYFOEMWOTGVANV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NS(=O)(=O)C2CC2)(O)O |
Computed by PubChem (NCBI)