cas: 1218790-88-5 — see every product listed under this CAS number, including other names
(4-(Hydroxymethyl)-3-methylphenyl)boronic acid 96% (CAS 1218790-88-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A833001-250mg |
| cas | 1218790-88-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 25g | 1744.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A833001 |
[4-(hydroxymethyl)-3-methylphenyl]boronic acid (CAS 1218790-88-5) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: [4-(hydroxymethyl)-3-methylphenyl]boronic acid. InChIKey: SLIUMAXFJNQYHZ-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | [4-(hydroxymethyl)-3-methylphenyl]boronic acid |
| InChIKey | SLIUMAXFJNQYHZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CO)C)(O)O |
Computed by PubChem (NCBI)