cas: 1451375-04-4 — see every product listed under this CAS number, including other names
(4-(Methoxycarbonyl)-3-(trifluoromethyl)phenyl)boronic acid 95+% (CAS 1451375-04-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A989590-250mg |
| cas | 1451375-04-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 4520.00 Pln | |
| Ambeed | 10g | 8107.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A989590 |
[4-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 1451375-04-4) is a chemical compound with the molecular formula C9H8BF3O4 and a molecular weight of 247.97 g/mol. IUPAC name: [4-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: NPQVSVOCCSWALW-UHFFFAOYSA-N.
| Molecular formula | C9H8BF3O4 |
|---|---|
| Molecular weight | 247.97 g/mol |
| IUPAC name | [4-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | NPQVSVOCCSWALW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)