CAS 1150114-32-1 appears in our catalog under these names: 2-(Methoxycarbonyl)-3-(trifluoromethyl)phenylboronic acid, 96%, (2-(Methoxycarbonyl)-3-(trifluoromethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[2-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 1150114-32-1) is a chemical compound with the molecular formula C9H8BF3O4 and a molecular weight of 247.97 g/mol. IUPAC name: [2-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: QYLNVMDKWLXRDV-UHFFFAOYSA-N.
| Molecular formula | C9H8BF3O4 |
|---|---|
| Molecular weight | 247.97 g/mol |
| IUPAC name | [2-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | QYLNVMDKWLXRDV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(F)(F)F)C(=O)OC)(O)O |
Computed by PubChem (NCBI)