cas: 1451375-04-4 — see every product listed under this CAS number, including other names
(4-(Methoxycarbonyl)-3-(trifluoromethyl)phenyl)boronic acid, 95% (CAS 1451375-04-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F607843-250MG |
| cas | 1451375-04-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 1g | 1695.25 Pln | |
| Fluorochem | 5g | 5725.09 Pln | |
| Fluorochem | 10g | 10249.53 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 1451375-04-4) is a chemical compound with the molecular formula C9H8BF3O4 and a molecular weight of 247.97 g/mol. IUPAC name: [4-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: NPQVSVOCCSWALW-UHFFFAOYSA-N.
| Molecular formula | C9H8BF3O4 |
|---|---|
| Molecular weight | 247.97 g/mol |
| IUPAC name | [4-methoxycarbonyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | NPQVSVOCCSWALW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)