CAS 1072951-42-8 appears in our catalog under these names: 2-(Methoxycarbonyl)-4-(trifluoromethyl)phenylboronic acid, 97%, (2-(Methoxycarbonyl)-4-(trifluoromethyl)phenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]boronic acid (CAS 1072951-42-8) is a chemical compound with the molecular formula C9H8BF3O4 and a molecular weight of 247.97 g/mol. IUPAC name: [2-methoxycarbonyl-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: AAXBJDGTBHKXKN-UHFFFAOYSA-N.
| Molecular formula | C9H8BF3O4 |
|---|---|
| Molecular weight | 247.97 g/mol |
| IUPAC name | [2-methoxycarbonyl-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | AAXBJDGTBHKXKN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)C(=O)OC)(O)O |
Computed by PubChem (NCBI)