cas: 1704097-46-0 — see every product listed under this CAS number, including other names
(4-(N-cyclopentylsulfamoyl)-3,5-dimethylphenyl)boronic acid, 95%, 95% (CAS 1704097-46-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ARDH-250mg |
| cas | 1704097-46-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(cyclopentylsulfamoyl)-3,5-dimethylphenyl]boronic acid (CAS 1704097-46-0) is a chemical compound with the molecular formula C13H20BNO4S and a molecular weight of 297.2 g/mol. IUPAC name: [4-(cyclopentylsulfamoyl)-3,5-dimethylphenyl]boronic acid. InChIKey: OTXYDMVQKWRULL-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4S |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | [4-(cyclopentylsulfamoyl)-3,5-dimethylphenyl]boronic acid |
| InChIKey | OTXYDMVQKWRULL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)NC2CCCC2)C)(O)O |
Computed by PubChem (NCBI)