Products 2096335-96-3

CAS 2096335-96-3 is the registry number for 3-(Phenylsulfonyl)propylboronic acid diethanolamine ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[3-(benzenesulfonyl)propyl]-1,3,6,2-dioxazaborocane (CAS 2096335-96-3) is a chemical compound with the molecular formula C13H20BNO4S and a molecular weight of 297.2 g/mol. IUPAC name: 2-[3-(benzenesulfonyl)propyl]-1,3,6,2-dioxazaborocane. InChIKey: GVGMISKQPXUOMP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20BNO4S
Molecular weight297.2 g/mol
IUPAC name2-[3-(benzenesulfonyl)propyl]-1,3,6,2-dioxazaborocane
InChIKeyGVGMISKQPXUOMP-UHFFFAOYSA-N
SMILESB1(OCCNCCO1)CCCS(=O)(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)