CAS 1704097-46-0 appears in our catalog under these names: (4-(N-Cyclopentylsulfamoyl)-3,5-dimethylphenyl)boronic acid, 95%, (4–(N–Cyclopentylsulfamoyl)–3, 5–dimethylphenyl)boronic acid, (4-(N-cyclopentylsulfamoyl)-3,5-dimethylphenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
[4-(cyclopentylsulfamoyl)-3,5-dimethylphenyl]boronic acid (CAS 1704097-46-0) is a chemical compound with the molecular formula C13H20BNO4S and a molecular weight of 297.2 g/mol. IUPAC name: [4-(cyclopentylsulfamoyl)-3,5-dimethylphenyl]boronic acid. InChIKey: OTXYDMVQKWRULL-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4S |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | [4-(cyclopentylsulfamoyl)-3,5-dimethylphenyl]boronic acid |
| InChIKey | OTXYDMVQKWRULL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)NC2CCCC2)C)(O)O |
Computed by PubChem (NCBI)