CAS 909187-69-5 is the registry number for 2-Methyl-5-sulfamoylphenylboronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 909187-69-5) is a chemical compound with the molecular formula C13H20BNO4S and a molecular weight of 297.2 g/mol. IUPAC name: 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: RRDKUEMSNLMHIA-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4S |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | RRDKUEMSNLMHIA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)S(=O)(=O)N)C |
Computed by PubChem (NCBI)