cas: 763120-63-4 — see every product listed under this CAS number, including other names
(4-(Piperazin-1-ylmethyl)phenyl)boronic acid, 98+% (CAS 763120-63-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A680240-10g |
| cas | 763120-63-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 29859.76 Pln | |
| AmBeed | 5g | 17588.41 Pln | |
| AmBeed | 25g | 58549.33 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(piperazin-1-ylmethyl)phenyl]boronic acid (CAS 763120-63-4) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: [4-(piperazin-1-ylmethyl)phenyl]boronic acid. InChIKey: MXWIZZUTFZHLIB-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | [4-(piperazin-1-ylmethyl)phenyl]boronic acid |
| InChIKey | MXWIZZUTFZHLIB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN2CCNCC2)(O)O |
Computed by PubChem (NCBI)