CAS 1073354-99-0 appears in our catalog under these names: 3–Aminopyridine–5–boronic acid pinacol ester, 5-Aminopyridine-3-boronic acid, pinacol ester, 3-Aminopyridine-5-boronic acid, pinacol ester 95%, 5-Aminopyridine-3-boronic acid pinacol ester, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 50g, 250mg, 25g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine (CAS 1073354-99-0) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine. InChIKey: DAISWHFZWZZBBD-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine |
| InChIKey | DAISWHFZWZZBBD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)N |
Computed by PubChem (NCBI)