CAS 1073354-97-8 appears in our catalog under these names: 2-Aminopyridine-3-boronic acid, pinacol ester, 97%, 2–Aminopyridine–3–boronic acid pinacol ester, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg, 100g, 500g.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1073354-97-8) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: FSJAKASJCJZKET-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | FSJAKASJCJZKET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)N |
Computed by PubChem (NCBI)